ChemNet > CAS > 227958-96-5 ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate
227958-96-5 ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate
termék neve |
ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate |
Szinonimák |
ethyl 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate |
MF |
C13H11Cl2NO2S |
Molekulatömeg |
316.2029 |
InChI |
InChI=1/C13H11Cl2NO2S/c1-3-18-13(17)10-11(15)8-6-7(14)4-5-9(8)16-12(10)19-2/h4-6H,3H2,1-2H3 |
CAS-szám |
227958-96-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.42g/cm3 |
Olvadáspont |
133℃ |
Forráspont |
410.2°C at 760 mmHg |
Törésmutató |
1.643 |
Gyulladáspont |
201.9°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|